methyl 7-(4-methoxyphenyl)bicyclo[4.1.0]hepta-2,4-diene-7-carboxylate structure
|
Common Name | methyl 7-(4-methoxyphenyl)bicyclo[4.1.0]hepta-2,4-diene-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 32777-11-0 | Molecular Weight | 256.29600 | |
| Density | 1.186g/cm3 | Boiling Point | 342.3ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9ºC | |
| Name | methyl 7-(4-methoxyphenyl)bicyclo[4.1.0]hepta-2,4-diene-7-carboxylate |
|---|
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 342.3ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 141.9ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 2.47800 |
| Index of Refraction | 1.576 |
| InChIKey | NGFBFVCPBCXHCJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(c2ccc(OC)cc2)C2C=CC=CC21 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |