trimethyl [1,1'-biphenyl]-2,4',5-tricarboxylate structure
|
Common Name | trimethyl [1,1'-biphenyl]-2,4',5-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 32741-92-7 | Molecular Weight | 328.31600 | |
| Density | 1.223g/cm3 | Boiling Point | 483.4ºC at 760 mmHg | |
| Molecular Formula | C18H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | dimethyl 2-(4-methoxycarbonylphenyl)benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 483.4ºC at 760 mmHg |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.31600 |
| Flash Point | 213.7ºC |
| Exact Mass | 328.09500 |
| PSA | 78.90000 |
| LogP | 2.71340 |
| Index of Refraction | 1.555 |
| InChIKey | ZLRSGCDCVGSPKI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2cc(C(=O)OC)ccc2C(=O)OC)cc1 |
| HS Code | 2917399090 |
|---|
|
~%
trimethyl [1,1'... CAS#:32741-92-7 |
| Literature: Phillips; Chatterjee Journal of the American Chemical Society, 1958 , vol. 80, p. 1911,1914 |
|
~%
trimethyl [1,1'... CAS#:32741-92-7 |
| Literature: Phillips; Chatterjee Journal of the American Chemical Society, 1958 , vol. 80, p. 1911,1914 |
|
~%
trimethyl [1,1'... CAS#:32741-92-7 |
| Literature: Chatterjee,D.N.; Bhattacharjee,S.P. Tetrahedron, 1971 , vol. 27, p. 4153 - 4162 |
|
~%
trimethyl [1,1'... CAS#:32741-92-7 |
| Literature: Chatterjee,D.N.; Bhattacharjee,S.P. Tetrahedron, 1971 , vol. 27, p. 4153 - 4162 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| trimethyl biphenyl-2,4',5-tricarboxylate |
| biphenyl-2,5,4'-tricarboxylic acid trimethyl ester |
| Trimethyl-2,4',5-Biphenyl-tricarboxylat |
| Biphenyl-2,5,4'-tricarbonsaeure-trimethylester |
| EINECS 251-189-3 |