2,2'-Spirobi[2H-1-benzopyran]-6,6',7,7'-tetrol,3,3',4,4'-tetrahydro-4,4,4',4'-tetramethyl- structure
|
Common Name | 2,2'-Spirobi[2H-1-benzopyran]-6,6',7,7'-tetrol,3,3',4,4'-tetrahydro-4,4,4',4'-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 32737-35-2 | Molecular Weight | 372.41200 | |
| Density | 1.43g/cm3 | Boiling Point | 621.3ºC at 760mmHg | |
| Molecular Formula | C21H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.5ºC | |
| Name | 4,4,4',4'-tetramethyl-2,2'-spirobi[3H-chromene]-6,6',7,7'-tetrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 621.3ºC at 760mmHg |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.41200 |
| Flash Point | 329.5ºC |
| Exact Mass | 372.15700 |
| PSA | 99.38000 |
| LogP | 4.02570 |
| Index of Refraction | 1.683 |
| InChIKey | SZUGPQFFJXSTDD-UHFFFAOYSA-N |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(O)c(O)cc3O2)Oc2cc(O)c(O)cc21 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,6',7,7'-Tetrahydroxy-4,4,4',4'-tetramethyl-2,2'-spirobichroman |
| 6,6',7,7'-Tetrahydroxy-4,4,4',4'-tetramethyl-2,2'-spirobischroman |