5-(2-chloro-4-nitro-phenyl)-furan-2-carbaldehyde structure
|
Common Name | 5-(2-chloro-4-nitro-phenyl)-furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 327049-94-5 | Molecular Weight | 251.62300 | |
| Density | 1.454g/cm3 | Boiling Point | 401ºC at 760mmHg | |
| Molecular Formula | C11H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | 5-(2-chloro-4-nitrophenyl)furan-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 401ºC at 760mmHg |
| Molecular Formula | C11H6ClNO4 |
| Molecular Weight | 251.62300 |
| Flash Point | 196.3ºC |
| Exact Mass | 250.99900 |
| PSA | 76.03000 |
| LogP | 3.84390 |
| Index of Refraction | 1.627 |
| InChIKey | YLWXKADRQFEWGM-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00658943 |
| 5-(2-Chloro-4-nitrophenyl)-2-furaldehyde |
| 5-(2-Chloro-4-nitro-phenyl)-furan-2-carbaldehyde |