4-(dimethylamino)-6-(4-fluorophenyl)-2-oxopyran-3-carbonitrile structure
|
Common Name | 4-(dimethylamino)-6-(4-fluorophenyl)-2-oxopyran-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 326859-22-7 | Molecular Weight | 258.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(dimethylamino)-6-(4-fluorophenyl)-2-oxopyran-3-carbonitrile |
|---|
| Molecular Formula | C14H11FN2O2 |
|---|---|
| Molecular Weight | 258.24800 |
| Exact Mass | 258.08000 |
| PSA | 57.24000 |
| LogP | 2.38358 |
| InChIKey | OXKICLSTGGYBMY-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc(-c2ccc(F)cc2)oc(=O)c1C#N |
|
~68%
4-(dimethylamin... CAS#:326859-22-7 |
| Literature: Ram, Vishnu J.; Nath, Mahendra; Srivastava, Pratibha; Sarkhcl, Sanjay; Maulik, Prakas R. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 22 p. 3719 - 3723 |
|
~%
4-(dimethylamin... CAS#:326859-22-7 |
| Literature: Agarwal, Nidhi; Saxena, Abhishek S; Farhanullah; Goel, Atul; Ram, Vishnu J Tetrahedron, 2002 , vol. 58, # 43 p. 8793 - 8798 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |