Ethyl 2-phenyl-imidazole-4-carboxylate structure
|
Common Name | Ethyl 2-phenyl-imidazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 32683-00-4 | Molecular Weight | 216.23600 | |
| Density | 1.196g/cm3 | Boiling Point | 413.8ºC at 760mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | 210 °C | |
| MSDS | N/A | Flash Point | 204ºC | |
| Name | ethyl 2-phenyl-1H-imidazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 413.8ºC at 760mmHg |
| Melting Point | 210 °C |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 204ºC |
| Exact Mass | 216.09000 |
| PSA | 54.98000 |
| LogP | 2.25340 |
| Index of Refraction | 1.575 |
| InChIKey | UABZXMAUPKBULM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2)[nH]1 |
| Storage condition | 2-8°C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 2-phenyl-imidazole-4-carboxylate |
| 2-phenyl-1(3)H-imidazole-4-carboxylic acid ethyl ester |
| 2-Phenyl-1(3)H-imidazol-4-carbonsaeure-aethylester |