3-Cyclopropyl-5-nitro-1H-pyrazole
Modify Date: 2025-08-25 19:05:19
3-Cyclopropyl-5-nitro-1H-pyrazole structure
|
Common Name | 3-Cyclopropyl-5-nitro-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 326827-23-0 | Molecular Weight | 153.13900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Cyclopropyl-5-nitro-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7N3O2 |
|---|---|
| Molecular Weight | 153.13900 |
| Exact Mass | 153.05400 |
| PSA | 74.50000 |
| LogP | 1.71850 |
| InChIKey | CTSMOTWWAYPQLU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C2CC2)n[nH]1 |
| HS Code | 2933199090 |
|---|
|
~51%
3-Cyclopropyl-5... CAS#:326827-23-0 |
| Literature: Pharmacia and Upjohn S.p.A; Pharmacia and Upjohn Co. Patent: US6218418 B1, 2001 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-cyclopropylisonicotinaldehyde |
| 3-cyclopropyl-4-pyridinecarboxaldehyde |