monoacetyldapsone hydroxylamine
Modify Date: 2025-08-29 18:18:45
monoacetyldapsone hydroxylamine structure
|
Common Name | monoacetyldapsone hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 32604-86-7 | Molecular Weight | 306.33700 | |
| Density | 1.449g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[4-(hydroxyamino)phenyl]sulfonylphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.33700 |
| Exact Mass | 306.06700 |
| PSA | 107.37000 |
| LogP | 4.08220 |
| Index of Refraction | 1.665 |
| InChIKey | YUWDJHZQRAHBBW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccc(NO)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~82%
monoacetyldapso... CAS#:32604-86-7 |
| Literature: Vyas, Piyush M.; Roychowdhury, Sanjoy; Woster, Patrick M.; Svensson, Craig K. Biochemical Pharmacology, 2005 , vol. 70, # 2 p. 275 - 286 |
|
~%
monoacetyldapso... CAS#:32604-86-7 |
| Literature: Owari Yakugaku Zasshi, 1951 , vol. 71, p. 246,249 |
![Acetamide,N-[4-[(4-nitrophenyl)sulfonyl]phenyl]- structure](https://image.chemsrc.com/caspic/439/1775-37-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Monoacetyldapsone hydroxylamine |
| Madds-noh |