2'-Amino-5'-nitroacetophenone
2'-Amino-5'-nitroacetophenone structure
|
Common Name | 2'-Amino-5'-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 32580-41-9 | Molecular Weight | 180.16100 | |
| Density | 1.333 g/cm3 | Boiling Point | 332.9ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.1ºC | |
| Name | 1-(2-amino-5-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333 g/cm3 |
|---|---|
| Boiling Point | 332.9ºC at 760 mmHg |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16100 |
| Flash Point | 155.1ºC |
| Exact Mass | 180.05300 |
| PSA | 88.91000 |
| LogP | 2.48400 |
| Index of Refraction | 1.613 |
| InChIKey | WYSBWHYLQMVOOL-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc([N+](=O)[O-])ccc1N |
| HS Code | 2922399090 |
|---|
|
~%
2'-Amino-5'-nit... CAS#:32580-41-9 |
| Literature: US4379929 A1, ; |
|
~78%
2'-Amino-5'-nit... CAS#:32580-41-9 |
| Literature: US6342079 B1, ; Page column 3 ; |
|
~%
2'-Amino-5'-nit... CAS#:32580-41-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 37, # 20 p. 3400 - 3407 |
|
~%
2'-Amino-5'-nit... CAS#:32580-41-9 |
| Literature: Chemische Berichte, , vol. 48, p. 537,542 Anm. 2, 543, 573 |
|
~%
2'-Amino-5'-nit... CAS#:32580-41-9 |
| Literature: Chemische Berichte, , vol. 48, p. 537,542 Anm. 2, 543, 573 |
CAS#:736145-09-8
CAS#:736145-10-1| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethanone,1-(2-amino-5-nitrophenyl) |
| 2'-Amino-5'-nitroacetophenone |
| 5-Nitro-2-amino-acetophenon |
| 1-(2-Amino-5-nitro-phenyl)-aethanon |
| 1-(2-amino-5-nitrophenyl)ethan-1-one |
| 1-(2-amino-5-nitro-phenyl)-ethanone |