1-N-(7-chloroquinolin-4-yl)-4-N,4-N-diethylcyclohexane-1,4-diamine
Modify Date: 2025-11-26 11:17:19
1-N-(7-chloroquinolin-4-yl)-4-N,4-N-diethylcyclohexane-1,4-diamine structure
|
Common Name | 1-N-(7-chloroquinolin-4-yl)-4-N,4-N-diethylcyclohexane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 32571-44-1 | Molecular Weight | 331.88300 | |
| Density | 1.15g/cm3 | Boiling Point | 478.8ºC at 760 mmHg | |
| Molecular Formula | C19H26ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | 1-N-(7-chloroquinolin-4-yl)-4-N,4-N-diethylcyclohexane-1,4-diamine |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760 mmHg |
| Molecular Formula | C19H26ClN3 |
| Molecular Weight | 331.88300 |
| Flash Point | 243.4ºC |
| Exact Mass | 331.18200 |
| PSA | 28.16000 |
| LogP | 5.02610 |
| Index of Refraction | 1.601 |
| InChIKey | JLAYDKVSQLVTNK-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1CCC(Nc2ccnc3cc(Cl)ccc23)CC1 |
|
~%
1-N-(7-chloroqu... CAS#:32571-44-1
1-N-(7-chloroqu... CAS#:32571-44-1 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1208,1210 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |