[(cyclohexylamino)methylene]-1,1-bisphosphonate structure
|
Common Name | [(cyclohexylamino)methylene]-1,1-bisphosphonate | ||
|---|---|---|---|---|
| CAS Number | 32545-64-5 | Molecular Weight | 273.16100 | |
| Density | 1.54g/cm3 | Boiling Point | 561.3ºC at 760mmHg | |
| Molecular Formula | C7H17NO6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.3ºC | |
| Name | [(cyclohexylamino)methylene]-1,1-bisphosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 561.3ºC at 760mmHg |
| Molecular Formula | C7H17NO6P2 |
| Molecular Weight | 273.16100 |
| Flash Point | 293.3ºC |
| Exact Mass | 273.05300 |
| PSA | 146.71000 |
| LogP | 0.93860 |
| Index of Refraction | 1.541 |
| InChIKey | GBBBPWVJGMFZGX-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)C(NC1CCCCC1)P(=O)(O)O |
|
~46%
[(cyclohexylami... CAS#:32545-64-5 |
| Literature: Takeuchi; Sakamoto; Yoshida; Abe; Isomura Chemical and Pharmaceutical Bulletin, 1993 , vol. 41, # 4 p. 688 - 693 |
|
~%
[(cyclohexylami... CAS#:32545-64-5 |
| Literature: Wu, Mingshu; Chen, Ruyu; Huang, You Synthetic Communications, 2004 , vol. 34, # 8 p. 1393 - 1398 |
|
~%
[(cyclohexylami... CAS#:32545-64-5 |
| Literature: Goldeman, Waldemar; Kluczynski, Artur; Soroka, Miroslaw Tetrahedron Letters, 2012 , vol. 53, # 39 p. 5290 - 5292 |
|
~%
[(cyclohexylami... CAS#:32545-64-5 |
| Literature: Wu, Mingshu; Chen, Ruyu; Huang, You Synthetic Communications, 2004 , vol. 34, # 8 p. 1393 - 1398 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Acetic acid,2-[(cyanomethyl)thio] |
| 2-(cyanomethylsulfanyl)ethanoic acid |
| [(cyanomethyl)thio]acetic acid |
| 2-[(Cyanomethyl)thio]acetic Acid |
| N-cyclohexyl-1-aminomethane-1,1-diphosphonic acid |
| N-cyclohexyl-aminomethylene-1,1-bisphosphonic acid |
| N-cyclohexylaminomethanediphosphonate |
| N-cyclohexylaminomethanediphosphonic acid |
| 1-cyclohexyl-aminomethane-1,1-diphosphonic acid |
| cyanomethylsulfanyl-acetic acid |