2,2-bis[[(2-methyl-1-oxoallyl)oxy]methyl]-1,3-propanediyl bismethacrylate
Modify Date: 2025-08-24 19:01:26
![2,2-bis[[(2-methyl-1-oxoallyl)oxy]methyl]-1,3-propanediyl bismethacrylate Structure](https://image.chemsrc.com/caspic/086/3253-41-6.png)
2,2-bis[[(2-methyl-1-oxoallyl)oxy]methyl]-1,3-propanediyl bismethacrylate structure
|
Common Name | 2,2-bis[[(2-methyl-1-oxoallyl)oxy]methyl]-1,3-propanediyl bismethacrylate | ||
|---|---|---|---|---|
| CAS Number | 3253-41-6 | Molecular Weight | 408.44200 | |
| Density | 1.107g/cm3 | Boiling Point | 497.9ºC at 760mmHg | |
| Molecular Formula | C21H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | pentaerythritol tetramethacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 497.9ºC at 760mmHg |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.44200 |
| Flash Point | 213.2ºC |
| Exact Mass | 408.17800 |
| PSA | 105.20000 |
| LogP | 2.45000 |
| Index of Refraction | 1.479 |
| InChIKey | KGBBDBRJXGILTQ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| HS Code | 2916190090 |
|---|
|
~%
2,2-bis[[(2-met... CAS#:3253-41-6 |
| Literature: Journal of Polymer Science, Part A: Polymer Chemistry, , vol. 51, # 21 p. 4626 - 4636 |
|
~%
2,2-bis[[(2-met... CAS#:3253-41-6 |
| Literature: Doklady 6.Konf.vysokomol.Soedin.MoskauChem.Abstr., , p. 172 Doklady 6.Konf.vysokomol.Soedin.MoskauChem.Abstr., , p. 12455 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3-propanediylester |
| 2,2-bis[[(2-methyl-1-oxoallyl)oxy]methyl]-1,3-propanediyl bismethacrylate |
| Tetramethylolmethane tetramethacrylate |
| 1,3-Bis-methacryloyloxy-2,2-bis-methacryloyloxymethyl-propan |
| pentaerythritol tetrmethacrylate |
| Bismethacrylic acid 2,2-bis[(methacryloyloxy)methyl]-1,3-propanediyl ester |
| Pentaerythrityl tetramethacrylate |
| NEOPENTANETETRAYL METHACRYLATE |
| Dimethacrylic acid [2,2-bis[(methacryloyloxy)methyl]-1,3-propanediyl] ester |
| Tetra-O-methacryloyl-pentaerythrit |
| Penthaerythritol tetramethacrylate |
| tetra-O-methacryloyl-pentaerythritol |
| 2,2-bis[[(2-methyl-1-oxo-2-propenyl)oxy]methyl]-1,3-propanediyl ester |