3-Methyl-1-pentyn-3-yl carbanilate
Modify Date: 2025-09-18 21:57:48
3-Methyl-1-pentyn-3-yl carbanilate structure
|
Common Name | 3-Methyl-1-pentyn-3-yl carbanilate | ||
|---|---|---|---|---|
| CAS Number | 32496-85-8 | Molecular Weight | 217.26400 | |
| Density | 1.112g/cm3 | Boiling Point | 272.4ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.5ºC | |
| Name | 3-methylpent-1-yn-3-yl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 272.4ºC at 760 mmHg |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 118.5ºC |
| Exact Mass | 217.11000 |
| PSA | 38.33000 |
| LogP | 3.11000 |
| Index of Refraction | 1.561 |
| InChIKey | WAFZITIKYSEYOM-UHFFFAOYSA-N |
| SMILES | C#CC(C)(CC)OC(=O)Nc1ccccc1 |
|
~99%
3-Methyl-1-pent... CAS#:32496-85-8 |
| Literature: Newton, Rebecca; Savage, G. Paul Australian Journal of Chemistry, 2008 , vol. 61, # 6 p. 432 - 437 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| CARBANILIC ACID,3-METHYL-1-PENTYN-3-YL ESTER |
| 3-Methyl-1-pentyn-3-yl carbanilate |
| Phenyl-carbamidsaeure-(1-aethyl-1-methyl-prop-2-inylester) |
| phenyl-carbamic acid-(1-ethyl-1-methyl-prop-2-ynyl ester) |
| 3-methylpent-1-yn-3-yl phenylcarbamate |
| 1-Pentyn-3-ol,3-methyl-,carbanilate |