ethyl 4-[(6-oxo-1-cyclohexa-2,4-dienylidene)methylamino]benzoate structure
|
Common Name | ethyl 4-[(6-oxo-1-cyclohexa-2,4-dienylidene)methylamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 3246-76-2 | Molecular Weight | 269.29500 | |
| Density | 1.291g/cm3 | Boiling Point | 431.8ºC at 760 mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | ethyl 4-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760 mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 214.9ºC |
| Exact Mass | 269.10500 |
| PSA | 58.89000 |
| LogP | 3.31950 |
| Index of Refraction | 1.68 |
| InChIKey | LFPLHVSNSZORMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N=Cc2ccccc2O)cc1 |
| HS Code | 2925290090 |
|---|
|
~%
ethyl 4-[(6-oxo... CAS#:3246-76-2 |
| Literature: Brown,N.M.D.; Nonhebel,D.C. Tetrahedron, 1968 , vol. 24, p. 5655 - 5664 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Salicylaldehyd-p-carbethoxyanil |
| N-<p-Ethoxycarbonyl-phenyl>-salicylaldehydimin |
| 4-((E)-Hydroxyimino-methyl)-1-methyl-pyridinium,Jodid |
| 4-pyridinealdoxime methiodide |
| trans-N-Salicyliden-<4-ethoxycarbonyl-anilin> |
| 4-((E)-hydroxyimino-methyl)-1-methyl-pyridinium,iodide |
| 4-((E)-Salicylidenamino)-benzoesaeure-aethylester |
| ethyl 4-(2-hydroxybenzylideneamino)benzoate |
| 4-((E)-salicylidenamino)-benzoic acid ethyl ester |
| N-p-C2H5O2CC6H4-salicylaldimine |