N-[2-(Diethylamino)ethyl]-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide structure
|
Common Name | N-[2-(Diethylamino)ethyl]-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 32421-50-4 | Molecular Weight | 275.38900 | |
| Density | 1.05g/cm3 | Boiling Point | 472.3ºC at 760 mmHg | |
| Molecular Formula | C16H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.4ºC | |
| Name | N-[2-(diethylamino)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 472.3ºC at 760 mmHg |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.38900 |
| Flash Point | 239.4ºC |
| Exact Mass | 275.20000 |
| PSA | 47.86000 |
| LogP | 2.32800 |
| Index of Refraction | 1.533 |
| InChIKey | SEUIDLPNRJJFBX-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1Cc2ccccc2CN1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |