dibromide salt of the N,N'-dimethyl-4,4'-dipyridinium dication
Modify Date: 2025-09-24 11:20:26
dibromide salt of the N,N'-dimethyl-4,4'-dipyridinium dication structure
|
Common Name | dibromide salt of the N,N'-dimethyl-4,4'-dipyridinium dication | ||
|---|---|---|---|---|
| CAS Number | 3240-78-6 | Molecular Weight | 266.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dibromide salt of the N,N'-dimethyl-4,4'-dipyridinium dication |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14BrN2+ |
|---|---|
| Molecular Weight | 266.15700 |
| Exact Mass | 265.03400 |
| PSA | 7.76000 |
| LogP | 1.96070 |
| InChIKey | CLPHVHSZMGOZOH-UHFFFAOYSA-L |
| SMILES | C[n+]1ccc(-c2cc[n+](C)cc2)cc1.[Br-].[Br-] |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:15591-62-5| methyl viologen dibromide |
| N,N'-dimethyl-4,4'-bipyridinium dibromide |
| N,N'-dimethyl-4.4'-bipyridinium dibromide |
| 1,1'dimethyl-4,4'-bipyridinium bromide |
| 1,1'-dimethyl-4,4'-bipyridinium dibromide |
| N,N'-Dimethyl-4,4'-dipyridinium dibromide |