(Diacetoxyiodo)benzene structure
|
Common Name | (Diacetoxyiodo)benzene | ||
|---|---|---|---|---|
| CAS Number | 3240-34-4 | Molecular Weight | 322.096 | |
| Density | 1.6865 | Boiling Point | 456.8ºC at 760 mmHg | |
| Molecular Formula | C10H11IO4 | Melting Point | 161-165 ºC | |
| MSDS | Chinese USA | Flash Point | 230.1ºC | |
| Name | [acetyloxy(phenyl)-λ3-iodanyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6865 |
|---|---|
| Boiling Point | 456.8ºC at 760 mmHg |
| Melting Point | 161-165 ºC |
| Molecular Formula | C10H11IO4 |
| Molecular Weight | 322.096 |
| Flash Point | 230.1ºC |
| Exact Mass | 321.970184 |
| PSA | 52.60000 |
| LogP | 2.31880 |
| InChIKey | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| SMILES | CC(=O)OI(OC(C)=O)c1ccccc1 |
| Storage condition | -20°C |
| Water Solubility | INSOLUBLE |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25-S37/39-S26 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| RTECS | DA3525000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 29310095 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
An expedient procedure for the oxidative cleavage of olefinic bonds with PhI(OAc)2, NMO, and catalytic OsO4.
Org. Lett. 12(7) , 1552-5, (2010) PhI(OAc)(2) in the presence of OsO(4) (cat.) and 2,6-lutidine cleaves olefinic bonds to yield the corresponding carbonyl compounds, albeit, in some cases, with alpha-hydroxy ketones as byproduct. A mo... |
|
|
Palladium-catalyzed oxygenation of unactivated sp3 C-H bonds.
J. Am. Chem. Soc. 126 , 9542-9543, (2004) This communication describes a new palladium-catalyzed method for the oxygenation of unactivated sp3 C-H bonds. A wide variety of alkane substrates containing readily available oxime and/or pyridine d... |
|
|
Determination of vitamin C in tablets and fruits by titration with phenyliodosoacetate.
Il Farmaco 37(1) , 9-14, (1982)
|
| Iodosobenzene diacetate |
| bis-acetoxy iodobenzene |
| Phenyliodo diacetate |
| iodosobensene I,I-diacetate |
| Iodobenzene diacetate |
| Diacetoxy(phenyl)-λ-iodane |
| Iodine, bis(acetyloxy)phenyl- |
| phenyliodonium diacetate |
| Phenyliodine diacetate |
| iodobenzene 1,1-diacetate |
| EINECS 221-808-1 |
| Iodobenzenediacetate |
| Phenyliodoso acetate |
| phenyliodine(iii) diacetate |
| Benzene, (diacetoxyiodo)- |
| iodosobenzene 1,1-diacetate |
| Phenyliodosodiacetate |
| MFCD00008692 |
| (Diacetoxyiodo)benzene |
| bis(acetyloxy)(phenyl)-λ-iodane |