1H-Isoindole-1,3(2H)-dione, 2-(((3-methoxyphenyl)methylene)amino)-
Modify Date: 2024-04-05 10:57:28
1H-Isoindole-1,3(2H)-dione, 2-(((3-methoxyphenyl)methylene)amino)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione, 2-(((3-methoxyphenyl)methylene)amino)- | ||
|---|---|---|---|---|
| CAS Number | 32387-03-4 | Molecular Weight | 280.27800 | |
| Density | 1.27g/cm3 | Boiling Point | 470.1ºC at 760mmHg | |
| Molecular Formula | C16H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | 2-[(E)-(3-methoxyphenyl)methylideneamino]isoindole-1,3-dione |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 470.1ºC at 760mmHg |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.27800 |
| Flash Point | 238.1ºC |
| Exact Mass | 280.08500 |
| PSA | 58.97000 |
| LogP | 2.26320 |
| Index of Refraction | 1.631 |
| InChIKey | XQZAQDLKUMZXTG-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=NN2C(=O)c3ccccc3C2=O)c1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |