2-(3-Hydroxyphenyl)quinoline-4-carboxylic acid
Modify Date: 2025-10-21 12:10:42
2-(3-Hydroxyphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(3-Hydroxyphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 32366-58-8 | Molecular Weight | 265.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-Hydroxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11NO3 |
|---|---|
| Molecular Weight | 265.26300 |
| Exact Mass | 265.07400 |
| PSA | 70.42000 |
| LogP | 3.30560 |
| InChIKey | VECNLFVATDBRIW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2cccc(O)c2)nc2ccccc12 |
| HS Code | 2933499090 |
|---|
|
~%
2-(3-Hydroxyphe... CAS#:32366-58-8 |
| Literature: Buu-Hoi et al. Bulletin de la Societe Chimique de France, 1956 , p. 629,631 |
|
~%
2-(3-Hydroxyphe... CAS#:32366-58-8 |
| Literature: Kalle and Co. Patent: DE284233 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 720 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-hydroxy-phenyl)-quinoline-4-carboxylic acid |
| 3'-Hydroxy-2-biphenylcarbonsaeure |
| 2-(3'-hydroxyphenyl)benzoic acid |
| 3'-hydroxy biphenyl-2-carboxylic acid |
| 2-(3-Hydroxy-phenyl)-chinolin-4-carbonsaeure |