phenyl phosphate dipotassium salt
Modify Date: 2025-09-26 21:36:27
phenyl phosphate dipotassium salt structure
|
Common Name | phenyl phosphate dipotassium salt | ||
|---|---|---|---|---|
| CAS Number | 32348-89-3 | Molecular Weight | 250.27200 | |
| Density | 1.499g/cm3 | Boiling Point | 346.9ºC at 760mmHg | |
| Molecular Formula | C6H5K2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | phenyl phosphate dipotassium salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.499g/cm3 |
|---|---|
| Boiling Point | 346.9ºC at 760mmHg |
| Molecular Formula | C6H5K2O4P |
| Molecular Weight | 250.27200 |
| Flash Point | 163.6ºC |
| Exact Mass | 249.92000 |
| PSA | 82.23000 |
| LogP | 2.03450 |
| InChIKey | DVXOPOCXFDGNKS-UHFFFAOYSA-L |
| SMILES | O=P([O-])([O-])Oc1ccccc1.[K+].[K+] |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| dipotassium phenyl phosphate |
| Phosphorsaeure-monophenylester,Kaliumsalz |
| Phosphoric acid phenyl=dipotassium salt |
| phosphoric acid monophenyl ester,potassium salt |