H-Glu(OMe)-OBzl.TosOH
Modify Date: 2025-10-06 17:43:24
H-Glu(OMe)-OBzl.TosOH structure
|
Common Name | H-Glu(OMe)-OBzl.TosOH | ||
|---|---|---|---|---|
| CAS Number | 32326-55-9 | Molecular Weight | 423.48000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | h-glu(ome)-obzl tos |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H25NO7S |
|---|---|
| Molecular Weight | 423.48000 |
| Exact Mass | 423.13500 |
| PSA | 141.37000 |
| LogP | 4.03310 |
| InChIKey | DVKWXOZIOZDBJY-MERQFXBCSA-N |
| SMILES | COC(=O)CCC(N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| l-glutamic acid a-benzyl-y-methyl diester p-tosylate |