Diallyl chlorendate
Modify Date: 2025-08-21 18:17:01
Diallyl chlorendate structure
|
Common Name | Diallyl chlorendate | ||
|---|---|---|---|---|
| CAS Number | 3232-62-0 | Molecular Weight | 468.97100 | |
| Density | 1.56g/cm3 | Boiling Point | 495.1ºC at 760mmHg | |
| Molecular Formula | C15H12Cl6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.4ºC | |
| Name | bis(prop-2-enyl) 1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 495.1ºC at 760mmHg |
| Molecular Formula | C15H12Cl6O4 |
| Molecular Weight | 468.97100 |
| Flash Point | 176.4ºC |
| Exact Mass | 465.88700 |
| PSA | 52.60000 |
| LogP | 4.52270 |
| Index of Refraction | 1.576 |
| InChIKey | CJKWEXMFQPNNTL-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1C(C(=O)OCC=C)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| HS Code | 2917209090 |
|---|
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Diallyl chlorendate |
| EINECS 221-775-3 |
| Diallyl 1,4,5,6,7,7-hexachlorobicyclo(2.2.1)hept-5-ene-2,3-dicarboxylate |
| Chlorendic acid,diallyl ester |