1H-Indolizino[8,7-b]indole-5-carboxylic acid, 2,3,5,6,11,11b-hexahydro-3-oxo-, methyl ester
Modify Date: 2025-08-20 23:09:00
![1H-Indolizino[8,7-b]indole-5-carboxylic acid, 2,3,5,6,11,11b-hexahydro-3-oxo-, methyl ester Structure](https://image.chemsrc.com/caspic/385/32283-52-6.png)
1H-Indolizino[8,7-b]indole-5-carboxylic acid, 2,3,5,6,11,11b-hexahydro-3-oxo-, methyl ester structure
|
Common Name | 1H-Indolizino[8,7-b]indole-5-carboxylic acid, 2,3,5,6,11,11b-hexahydro-3-oxo-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 32283-52-6 | Molecular Weight | 284.31000 | |
| Density | 1.38g/cm3 | Boiling Point | 516.6ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
| Name | methyl 3-oxo-1,2,5,6,11,11b-hexahydroindolizino[8,7-b]indole-5-carboxylate |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 516.6ºC at 760 mmHg |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31000 |
| Flash Point | 266.2ºC |
| Exact Mass | 284.11600 |
| PSA | 62.40000 |
| LogP | 1.86700 |
| Index of Refraction | 1.676 |
| InChIKey | QVCCUGYLVYNCBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C2CCC(=O)N12 |
|
~%
1H-Indolizino[8... CAS#:32283-52-6 |
| Literature: Irikawa, Hajime; Toyoda, Yasuhiro; Kumagai, Hiroaki; Okumura, Yasuaki Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 3 p. 880 - 887 |
|
~%
1H-Indolizino[8... CAS#:32283-52-6 |
| Literature: Toyoda, Yasuhiro; Kumagai, Hiroaki; Irikawa, Hajime; Okumura, Yasuaki Chemistry Letters, 1982 , p. 903 - 906 |
![trans-indolizino[8,7-b]indole-5-carboxylic acid methyl ester structure](https://image.chemsrc.com/caspic/137/70004-59-0.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |