1-(2-hydroxy-4-methoxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one
Modify Date: 2025-10-22 06:19:54
1-(2-hydroxy-4-methoxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one structure
|
Common Name | 1-(2-hydroxy-4-methoxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 32274-69-4 | Molecular Weight | 270.28000 | |
| Density | 1.282g/cm3 | Boiling Point | 522.1ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | 1-(2-hydroxy-4-methoxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 522.1ºC at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 198.5ºC |
| Exact Mass | 270.08900 |
| PSA | 66.76000 |
| LogP | 3.00250 |
| Index of Refraction | 1.657 |
| InChIKey | REZLOMBHXVOHSX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2cccc(O)c2)c(O)c1 |
| HS Code | 2914509090 |
|---|
|
~50%
1-(2-hydroxy-4-... CAS#:32274-69-4 |
| Literature: Pouget; Fagnere; Basly; Besson; Champavier; Habrioux; Chulia Pharmaceutical Research, 2002 , vol. 19, # 3 p. 286 - 291 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:32274-72-9| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2',3-Dihydroxy-4'-methoxychalcone |
| trans-2',3-Dihydroxy-4'-methoxychalcone |