N-[bis(aziridin-1-yl)phosphoryl]-4-chloro-6-methoxypyrimidin-2-amine structure
|
Common Name | N-[bis(aziridin-1-yl)phosphoryl]-4-chloro-6-methoxypyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 3223-15-2 | Molecular Weight | 289.65900 | |
| Density | 1.57g/cm3 | Boiling Point | 460.8ºC at 760 mmHg | |
| Molecular Formula | C9H13ClN5O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | N-[bis(aziridin-1-yl)phosphoryl]-4-chloro-6-methoxypyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 460.8ºC at 760 mmHg |
| Molecular Formula | C9H13ClN5O2P |
| Molecular Weight | 289.65900 |
| Flash Point | 232.5ºC |
| Exact Mass | 289.05000 |
| PSA | 79.94000 |
| LogP | 1.23860 |
| Index of Refraction | 1.638 |
| InChIKey | DPDJHCXUDIKSPF-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)nc(NP(=O)(N2CC2)N2CC2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bis-aziridin-1-yl-phosphinic acid 4-chloro-6-methoxy-pyrimidin-2-ylamide |