N-(2,3-Dihydro-1H-inden-5-yl)-2-(4-hydroxyphenyl)acetamide structure
|
Common Name | N-(2,3-Dihydro-1H-inden-5-yl)-2-(4-hydroxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 321853-28-5 | Molecular Weight | 267.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,3-Dihydro-1H-inden-5-yl)-2-(4-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NO2 |
|---|---|
| Molecular Weight | 267.32200 |
| Exact Mass | 267.12600 |
| PSA | 49.33000 |
| LogP | 3.13510 |
| InChIKey | QTOMIDYVTFNRAN-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(O)cc1)Nc1ccc2c(c1)CCC2 |
| HS Code | 2924299090 |
|---|
|
~88%
N-(2,3-Dihydro-... CAS#:321853-28-5 |
| Literature: Grella; Danso-Danquah; Safo; Joshi; Kister; Marden; Hoffman; Abraham Journal of Medicinal Chemistry, 2000 , vol. 43, # 25 p. 4726 - 4737 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| dihydroindenylhydroxyphenylacetamide |