4-Formyl-2-methoxyphenyl 2-chlorobenzoate structure
|
Common Name | 4-Formyl-2-methoxyphenyl 2-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 321726-59-4 | Molecular Weight | 290.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Formyl-2-methoxyphenyl 2-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11ClO4 |
|---|---|
| Molecular Weight | 290.69800 |
| Exact Mass | 290.03500 |
| PSA | 52.60000 |
| LogP | 3.38030 |
| InChIKey | PXMDYNSNBXIDHA-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)ccc1OC(=O)c1ccccc1Cl |
| HS Code | 2916399090 |
|---|
|
~84%
4-Formyl-2-meth... CAS#:321726-59-4 |
| Literature: Dikusar; Kozlov Russian Journal of Organic Chemistry, 2005 , vol. 41, # 7 p. 992 - 996 |
|
~%
4-Formyl-2-meth... CAS#:321726-59-4 |
| Literature: Dikusar; Kozlov Russian Journal of Organic Chemistry, 2005 , vol. 41, # 7 p. 992 - 996 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-formyl-2-methoxyphenyl bromoacetate |
| Acetic acid,bromo-,4-formyl-2-methoxyphenyl ester |
| 4-formyl-2-methoxyphenyl o-chlorobenzoate |