Uracil, 5-(diethylamino)-3-ethyl-6-methyl-1-phenyl-
Modify Date: 2025-09-22 20:06:40
Uracil, 5-(diethylamino)-3-ethyl-6-methyl-1-phenyl- structure
|
Common Name | Uracil, 5-(diethylamino)-3-ethyl-6-methyl-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 32150-52-0 | Molecular Weight | 301.38300 | |
| Density | 1.16g/cm3 | Boiling Point | 404.1ºC at 760mmHg | |
| Molecular Formula | C17H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | 5-(diethylamino)-3-ethyl-6-methyl-1-phenylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 404.1ºC at 760mmHg |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.38300 |
| Flash Point | 159.7ºC |
| Exact Mass | 301.17900 |
| PSA | 47.24000 |
| LogP | 2.17370 |
| Index of Refraction | 1.589 |
| InChIKey | NLGFLXKEBMNEDE-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c(C)n(-c2ccccc2)c(=O)n(CC)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-diethylamino-3-ethyl-6-methyl-1-phenyl-1H-pyrimidine-2,4-dione |
| Uracil,5-(diethylamino)-3-ethyl-6-methyl-1-phenyl |
| 5-Diethylamino-3-ethyl-6-methyl-1-phenyluracil |
| 2,4(1H,3H)-Pyrimidinedione,5-diethylamino-3-ethyl-6-methyl-1-phenyl |
| 5-(diethylamino)-3-ethyl-6-methyl-1-phenylpyrimidine-2,4(1h,3h)-dione |