1-Cyclopentyl-5-(dimethylamino)-3,6-dimethylpyrimidine-2,4(1H,3H)-dione
Modify Date: 2025-10-18 08:02:33
1-Cyclopentyl-5-(dimethylamino)-3,6-dimethylpyrimidine-2,4(1H,3H)-dione structure
|
Common Name | 1-Cyclopentyl-5-(dimethylamino)-3,6-dimethylpyrimidine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 32150-44-0 | Molecular Weight | 251.32500 | |
| Density | 1.17g/cm3 | Boiling Point | 344.1ºC at 760mmHg | |
| Molecular Formula | C13H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6ºC | |
| Name | 1-cyclopentyl-5-(dimethylamino)-3,6-dimethylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 344.1ºC at 760mmHg |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.32500 |
| Flash Point | 136.6ºC |
| Exact Mass | 251.16300 |
| PSA | 47.24000 |
| LogP | 1.03650 |
| Index of Refraction | 1.565 |
| InChIKey | ADLZRPUDXVXGRQ-UHFFFAOYSA-N |
| SMILES | Cc1c(N(C)C)c(=O)n(C)c(=O)n1C1CCCC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Cyclopentyl-3,6-dimethyl-5-dimethylaminouracil |
| 1-cyclopentyl-5-dimethylamino-3,6-dimethyl-1H-pyrimidine-2,4-dione |
| Uracil,1-cyclopentyl-3,6-dimethyl-5-dimethylamino |