Vanillic acid glucoside
Modify Date: 2025-08-25 17:46:19
Vanillic acid glucoside structure
|
Common Name | Vanillic acid glucoside | ||
|---|---|---|---|---|
| CAS Number | 32142-31-7 | Molecular Weight | 330.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O9 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Vanillic acid glucosideVanillic acid glucoside is isolated from the fruits of C. annuum as well as the leaves of various additional plants. Vanillic acid glucoside belongs to a class of compounds known as hydrolyzable tannins and can be phytotoxic against different species. |
| Name | 3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Vanillic acid glucoside is isolated from the fruits of C. annuum as well as the leaves of various additional plants. Vanillic acid glucoside belongs to a class of compounds known as hydrolyzable tannins and can be phytotoxic against different species. |
|---|---|
| Related Catalog |
| Molecular Formula | C14H18O9 |
|---|---|
| Molecular Weight | 330.28700 |
| Exact Mass | 330.09500 |
| PSA | 145.91000 |
| InChIKey | JYFOSWJYZIVJPO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OC2C(C(C(C(O2)CO)O)O)O |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:121-34-6| 4-Hydroxy-3-methoxybenzoic acid 4-|A-D-glucoside |
| Vanillic acid 4-|A-D-glucopyranoside |
| Vanillic acid 4-|A-D-glucoside |