trimethyl 5-methoxybenzene-1,2,4-tricarboxylate
Modify Date: 2025-08-23 08:44:29
trimethyl 5-methoxybenzene-1,2,4-tricarboxylate structure
|
Common Name | trimethyl 5-methoxybenzene-1,2,4-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 32136-60-0 | Molecular Weight | 282.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl 5-methoxybenzene-1,2,4-tricarboxylate |
|---|
| Molecular Formula | C13H14O7 |
|---|---|
| Molecular Weight | 282.24600 |
| Exact Mass | 282.07400 |
| PSA | 88.13000 |
| LogP | 1.05500 |
| InChIKey | AAUNKVZRYQTUNI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(=O)OC)c(C(=O)OC)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |