2-Cyclopenten-1-one,4,5-bis[(3-nitrophenyl)amino]- structure
|
Common Name | 2-Cyclopenten-1-one,4,5-bis[(3-nitrophenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 32116-48-6 | Molecular Weight | 354.31700 | |
| Density | 1.526g/cm3 | Boiling Point | 620.4ºC at 760 mmHg | |
| Molecular Formula | C17H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329ºC | |
| Name | 4,5-bis(3-nitroanilino)cyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 620.4ºC at 760 mmHg |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.31700 |
| Flash Point | 329ºC |
| Exact Mass | 354.09600 |
| PSA | 132.77000 |
| LogP | 4.09550 |
| Index of Refraction | 1.747 |
| InChIKey | JWGRDMALPJVFAG-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(Nc2cccc([N+](=O)[O-])c2)C1Nc1cccc([N+](=O)[O-])c1 |
|
~%
2-Cyclopenten-1... CAS#:32116-48-6 |
| Literature: Lewis; Mulquiney Australian Journal of Chemistry, 1979 , vol. 32, p. 1079,1088 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (+-)-trans-4,5-bis-(3-nitro-anilino)-cyclopent-2-enone |