Fluorobis(methylphenylamino)phosphine oxide
Modify Date: 2025-12-01 12:25:15
Fluorobis(methylphenylamino)phosphine oxide structure
|
Common Name | Fluorobis(methylphenylamino)phosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 321-35-7 | Molecular Weight | 278.26200 | |
| Density | 1.248g/cm3 | Boiling Point | 365.5ºC at 760mmHg | |
| Molecular Formula | C14H16FN2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.8ºC | |
| Name | N-[fluoro-(N-methylanilino)phosphoryl]-N-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 365.5ºC at 760mmHg |
| Molecular Formula | C14H16FN2OP |
| Molecular Weight | 278.26200 |
| Flash Point | 174.8ºC |
| Exact Mass | 278.09800 |
| PSA | 33.36000 |
| LogP | 4.33680 |
| Index of Refraction | 1.605 |
| InChIKey | IEQCSXWXMOVAKJ-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)P(=O)(F)N(C)c1ccccc1 |
|
~%
Fluorobis(methy... CAS#:321-35-7 |
| Literature: Heap; Saunders Journal of the Chemical Society, 1948 , p. 1315 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N'-dimethyl-N,N'-diphenyl-diamidophosphoryl fluoride |
| N.N'-Dimethyl-N.N'-diphenyl-diamidophosphorsaeure-fluorid |
| N,N'-Dimethyl-N,N'-diphenylphosphorodiamidic fluoride |
| Phosphorodiamidic fluoride,N,N'-dimethyl-N,N'-diphenyl |
| N,N'-Dimethyl-N,N'-diphenyl-diamidophosphorylfluorid |