rhinocaine
Modify Date: 2025-10-06 07:42:19
rhinocaine structure
|
Common Name | rhinocaine | ||
|---|---|---|---|---|
| CAS Number | 32066-26-5 | Molecular Weight | 273.37000 | |
| Density | 1.05g/cm3 | Boiling Point | 353.1ºC at 760mmHg | |
| Molecular Formula | C17H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.4ºC | |
| Name | (2,5-dimethyl-1-prop-2-enylpiperidin-4-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760mmHg |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37000 |
| Flash Point | 113.4ºC |
| Exact Mass | 273.17300 |
| PSA | 29.54000 |
| LogP | 3.06620 |
| Index of Refraction | 1.539 |
| InChIKey | GCJXHLAUPMDQPQ-UHFFFAOYSA-N |
| SMILES | C=CCN1CC(C)C(OC(=O)c2ccccc2)CC1C |
| HS Code | 2933399090 |
|---|
|
~%
rhinocaine CAS#:32066-26-5 |
| Literature: Nasarow et al. Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1958 , p. 739,741;engl.Ausg.S.714,716 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Rinocaine |
| Ridocaine |
| Rhinocaine |