Thiourea,N-(2,5-dimethoxyphenyl)-N'-phenyl- structure
|
Common Name | Thiourea,N-(2,5-dimethoxyphenyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 32065-63-7 | Molecular Weight | 288.36500 | |
| Density | 1.277g/cm3 | Boiling Point | 420.9ºC at 760mmHg | |
| Molecular Formula | C15H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | N-methyl-N-[(2,5-dimethoxyphenyl)methyl]amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760mmHg |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.36500 |
| Flash Point | 208.4ºC |
| Exact Mass | 288.09300 |
| PSA | 74.61000 |
| LogP | 3.65870 |
| Index of Refraction | 1.683 |
| InChIKey | DYIPNXQBWVUFEX-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(NC(=S)Nc2ccccc2)c1 |
| HS Code | 2930909090 |
|---|
|
~%
Thiourea,N-(2,5... CAS#:32065-63-7 |
| Literature: Baessler Chemische Berichte, 1884 , vol. 17, p. 2124 |
|
~79%
Thiourea,N-(2,5... CAS#:32065-63-7 |
| Literature: Khan, Khalid Mohammed; Naz, Farzana; Taha, Muhammad; Khan, Ajmal; Perveen, Shahnaz; Choudhary; Voelter, Wolfgang European Journal of Medicinal Chemistry, 2014 , vol. 74, p. 314 - 323 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2,5-dimethoxyphenyl)methyl-N-methylamine |
| N-(2,5-Dimethoxybenzyl)-N-methylamine |
| N-(2,5-dimethoxy-phenyl)-N'-phenyl-thiourea |
| 1-(2,5-dimethoxyphenyl)-3-phenylthiourea |
| N-(2,5-Dimethoxy-phenyl)-N'-phenyl-thioharnstoff |