2-Ethyl-2-methylhexanoic acid 3-piperidinopropyl ester
Modify Date: 2025-09-11 17:54:48
2-Ethyl-2-methylhexanoic acid 3-piperidinopropyl ester structure
|
Common Name | 2-Ethyl-2-methylhexanoic acid 3-piperidinopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 32051-68-6 | Molecular Weight | 283.44900 | |
| Density | 0.933g/cm3 | Boiling Point | 368.4ºC at 760mmHg | |
| Molecular Formula | C17H33NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.7ºC | |
| Name | 3-piperidin-1-ylpropyl 2-ethyl-2-methylhexanoate |
|---|
| Density | 0.933g/cm3 |
|---|---|
| Boiling Point | 368.4ºC at 760mmHg |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.44900 |
| Flash Point | 119.7ºC |
| Exact Mass | 283.25100 |
| PSA | 29.54000 |
| LogP | 3.95000 |
| Index of Refraction | 1.465 |
| InChIKey | BFQVQBCLVWGWNC-UHFFFAOYSA-N |
| SMILES | CCCCC(C)(CC)C(=O)OCCCN1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |