1,3-Bis(o-chlorobenzyl)thiourea structure
|
Common Name | 1,3-Bis(o-chlorobenzyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 31964-49-5 | Molecular Weight | 325.25600 | |
| Density | 1.322g/cm3 | Boiling Point | 456.7ºC at 760mmHg | |
| Molecular Formula | C15H14Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | 1,3-bis[(2-chlorophenyl)methyl]thiourea |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 456.7ºC at 760mmHg |
| Molecular Formula | C15H14Cl2N2S |
| Molecular Weight | 325.25600 |
| Flash Point | 230ºC |
| Exact Mass | 324.02500 |
| PSA | 63.19000 |
| LogP | 4.95990 |
| Index of Refraction | 1.645 |
| InChIKey | KNVQGYRKNYQADY-UHFFFAOYSA-N |
| SMILES | S=C(NCc1ccccc1Cl)NCc1ccccc1Cl |
|
~%
1,3-Bis(o-chlor... CAS#:31964-49-5 |
| Literature: Bradsher et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 6189,6191 |
|
~%
1,3-Bis(o-chlor... CAS#:31964-49-5 |
| Literature: McKay et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 4328,4330,4333 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |