Benzene,1,2,3,4,5-pentachloro-6-fluoro- structure
|
Common Name | Benzene,1,2,3,4,5-pentachloro-6-fluoro- | ||
|---|---|---|---|---|
| CAS Number | 319-87-9 | Molecular Weight | 268.32800 | |
| Density | 1.749g/cm3 | Boiling Point | 280ºC at 760 mmHg | |
| Molecular Formula | C6Cl5F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.3ºC | |
| Name | 1,2,3,4,5-pentachloro-6-fluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.749g/cm3 |
|---|---|
| Boiling Point | 280ºC at 760 mmHg |
| Molecular Formula | C6Cl5F |
| Molecular Weight | 268.32800 |
| Flash Point | 134.3ºC |
| Exact Mass | 265.84300 |
| LogP | 5.09270 |
| Index of Refraction | 1.575 |
| InChIKey | HGLRKPSTNKQNIS-UHFFFAOYSA-N |
| SMILES | Fc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2903999090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,pentachlorofluoro |
| Fluor-pentachlor-benzol |
| Pentachlor-fluor-benzol |
| Pentchlorofluorobenzene |
| 1-Fluor-pentachlor-benzol |
| 1-fluoro-2,3,4,5,6-pentachloro-benzene |
| PENTACHLOROFLUOROBENZENE |
| Fluoropentachlorobenzene |