1,3-adamantanediacetyl dichloride structure
|
Common Name | 1,3-adamantanediacetyl dichloride | ||
|---|---|---|---|---|
| CAS Number | 31898-14-3 | Molecular Weight | 358.088 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 406.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C14H16Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.9±22.3 °C | |
| Name | 2-[3-(2-chloro-2-oxoethyl)-1-adamantyl]acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.9±20.0 °C at 760 mmHg |
| Molecular Formula | C14H16Cl4O2 |
| Molecular Weight | 358.088 |
| Flash Point | 171.9±22.3 °C |
| Exact Mass | 355.990448 |
| PSA | 34.14000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | SNRBLHMEOQZIKA-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CC12CC3CC(C1)CC(CC(=O)Cl)(C3)C2 |
| HS Code | 2917209090 |
|---|
|
~%
1,3-adamantaned... CAS#:31898-14-3 |
| Literature: Traylor, T. G.; Koga, N.; Deardruff, L. A.; Sweptson, Paul N.; Ibers, James A. Journal of the American Chemical Society, 1984 , vol. 106, # 18 p. 5132 - 5143 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1,3-Adamantan-diacetylchlorid |
| 2,2'-Tricyclo[3.3.1.1]decane-1,3-diylbis(chloroacetyl chloride) |
| Tricyclo[3.3.1.1]decane-1,3-diacetyl dichloride, α,α'-dichloro- |
| adamantanediacetyl chloride |
| 1,3-adamantanediacetyl dichloride |