5-methoxy-2-(7-methoxy-2H-chromen-3-yl)phenol structure
|
Common Name | 5-methoxy-2-(7-methoxy-2H-chromen-3-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 3187-50-6 | Molecular Weight | 284.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-2-(7-methoxy-2H-chromen-3-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O4 |
|---|---|
| Molecular Weight | 284.30700 |
| Exact Mass | 284.10500 |
| PSA | 47.92000 |
| LogP | 3.34240 |
| InChIKey | KVDKLYOXDONCLC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=Cc3ccc(OC)cc3OC2)c(O)c1 |
|
~%
5-methoxy-2-(7-... CAS#:3187-50-6 |
| Literature: Bezuidenhoudt, Barend C. B.; Brandt, Edward V.; Roux, David G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 2767 - 2778 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2'-hydroxy-4',7-dimethoxyisoflav-3-ene |
| 2'-Hydroxy-4',7-dimethoxy-isoflav-3-en |