carbonic acid bis-biphenyl-4-yl ester
Modify Date: 2024-02-04 11:53:31
carbonic acid bis-biphenyl-4-yl ester structure
|
Common Name | carbonic acid bis-biphenyl-4-yl ester | ||
|---|---|---|---|---|
| CAS Number | 3185-74-8 | Molecular Weight | 366.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | carbonic acid bis-biphenyl-4-yl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H18O3 |
|---|---|
| Molecular Weight | 366.40900 |
| Exact Mass | 366.12600 |
| PSA | 35.53000 |
| LogP | 6.59840 |
| InChIKey | MHFGNKMUCULCRW-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(-c2ccccc2)cc1)Oc1ccc(-c2ccccc2)cc1 |
| HS Code | 2920909090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![4'-Bromo-[1,1'-biphenyl]-4-ol structure](https://image.chemsrc.com/caspic/347/29558-77-8.png)
CAS#:29558-77-8| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Kohlensaeure-bis-biphenyl-4-ylester |