2-chloro-3-oxo-n-phenylbutanamide structure
|
Common Name | 2-chloro-3-oxo-n-phenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 31844-92-5 | Molecular Weight | 211.64500 | |
| Density | 1.287g/cm3 | Boiling Point | 379.2ºC at 760mmHg | |
| Molecular Formula | C10H10ClNO2 | Melting Point | 141-142ºC | |
| MSDS | N/A | Flash Point | 183.1ºC | |
| Name | 2-chloro-3-oxo-n-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 379.2ºC at 760mmHg |
| Melting Point | 141-142ºC |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.64500 |
| Flash Point | 183.1ºC |
| Exact Mass | 211.04000 |
| PSA | 46.17000 |
| LogP | 1.89450 |
| Index of Refraction | 1.578 |
| InChIKey | LBHYOONLWAWEAA-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Cl)C(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| butanamide,N-(2-chlorophenyl)-3-oxo |
| N-Phenyl-2-chloro-3-oxobutyramide |
| N-Phenyl-2-chloro-3-oxobutanamide |
| 2-chloro-3-oxo-n-phenyl-butanamid |
| 2-chloro-N-phenyl-3-oxobutanamide |
| EINECS 250-835-1 |