(2-fluoro-2,2-dinitroethyl) carbonochloridate
Modify Date: 2025-09-17 09:17:55
(2-fluoro-2,2-dinitroethyl) carbonochloridate structure
|
Common Name | (2-fluoro-2,2-dinitroethyl) carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 31841-79-9 | Molecular Weight | 216.50900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H2ClFN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-fluoro-2,2-dinitroethyl) carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3H2ClFN2O6 |
|---|---|
| Molecular Weight | 216.50900 |
| Exact Mass | 215.95900 |
| PSA | 117.94000 |
| LogP | 1.58490 |
| InChIKey | IOOZLZOTIXZDGM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
|
~%
(2-fluoro-2,2-d... CAS#:31841-79-9 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4332744 A1, 1982 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Carbonochloridic acid,2-fluoro-2,2-dinitroethyl ester |
| 2-fluoro-2,2-dinitroethylchloroformate |