Cyclopentanone, 2-(2,2,3,3-tetrafluoro-1-oxopropyl)- (9CI)
Modify Date: 2025-08-25 00:23:02
Cyclopentanone, 2-(2,2,3,3-tetrafluoro-1-oxopropyl)- (9CI) structure
|
Common Name | Cyclopentanone, 2-(2,2,3,3-tetrafluoro-1-oxopropyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 318258-12-7 | Molecular Weight | 212.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,2,3,3-tetrafluoropropanoyl)cyclopentan-1-one |
|---|
| Molecular Formula | C8H8F4O2 |
|---|---|
| Molecular Weight | 212.14200 |
| Exact Mass | 212.04600 |
| PSA | 34.14000 |
| LogP | 1.82510 |
| InChIKey | OXZLDMADHKECKU-UHFFFAOYSA-N |
| SMILES | O=C1CCCC1C(=O)C(F)(F)C(F)F |
| HS Code | 2914700090 |
|---|
|
~66%
Cyclopentanone,... CAS#:318258-12-7 |
| Literature: Sevenard; Khomutov; Koryakova; Sattarova; Kodess; Stelten; Loop; Lork; Pashkevich; Roschenthaler Synthesis, 2000 , # 12 p. 1738 - 1748 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |