5,8-diethyl-7-hydroxydodecan-6-one structure
|
Common Name | 5,8-diethyl-7-hydroxydodecan-6-one | ||
|---|---|---|---|---|
| CAS Number | 31814-59-2 | Molecular Weight | 256.42400 | |
| Density | 0.889g/cm3 | Boiling Point | 283.5ºC at 760 mmHg | |
| Molecular Formula | C16H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.9ºC | |
| Name | 5,8-diethyl-7-hydroxydodecan-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.889g/cm3 |
|---|---|
| Boiling Point | 283.5ºC at 760 mmHg |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.42400 |
| Flash Point | 118.9ºC |
| Exact Mass | 256.24000 |
| PSA | 37.30000 |
| LogP | 4.34920 |
| Index of Refraction | 1.45 |
| InChIKey | RCEAKQYSPGVKEX-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)C(O)C(CC)CCCC |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 250-818-9 |
| 5,8-diethyl-7-hydroxy-dodecan-6-one |
| 5,8-Diethyl-7-hydroxy-6-dodecanone |
| 6-Dodecanone,5,8-diethyl-7-hydroxy |