Ly-466195 structure
|
Common Name | Ly-466195 | ||
|---|---|---|---|---|
| CAS Number | 317844-33-0 | Molecular Weight | 346.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24F2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ly-466195LY-466195 is a competitive antagonist of GLUK5 receptor. |
| Name | LY-466195 |
|---|
| Description | LY-466195 is a competitive antagonist of GLUK5 receptor. |
|---|---|
| References | 1. Andreou AP, Holland PR, Lasalandra MP, Goadsby PJ. Modulation of nociceptive dural input to the trigeminocervical complex through GluK1 kainate receptors. Pain. 2015 Mar;156(3):439-50. doi: 10.1097/01.j.pain.0000460325.25762.c0. PubMed PMID: 25679470. |
| Molecular Formula | C16H24F2N2O4 |
|---|---|
| Molecular Weight | 346.37 |
| InChIKey | OXQXJYQSWZFDBB-WJTVCTBASA-N |
| SMILES | O=C(O)C1CC2CC(CN3CC(F)(F)CC3C(=O)O)CCC2CN1 |