ethyl 5-acetyloxy-1H-indole-2-carboxylate
Modify Date: 2025-09-12 12:32:54
ethyl 5-acetyloxy-1H-indole-2-carboxylate structure
|
Common Name | ethyl 5-acetyloxy-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 31720-89-5 | Molecular Weight | 175.18400 | |
| Density | 1.275 g/cm3 | Boiling Point | 415.8ºC at 760 mmHg | |
| Molecular Formula | C10H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.2ºC | |
| Name | ethyl 5-acetyloxy-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275 g/cm3 |
|---|---|
| Boiling Point | 415.8ºC at 760 mmHg |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.18400 |
| Flash Point | 205.2ºC |
| Exact Mass | 175.06300 |
| PSA | 42.09000 |
| LogP | 2.09320 |
| Index of Refraction | 1.599 |
| InChIKey | ZWHLFJOLMBDDER-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(OC(C)=O)ccc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~99%
ethyl 5-acetylo... CAS#:31720-89-5 |
| Literature: AstraZeneca AB Patent: US6984657 B1, 2006 ; US 6984657 B1 |
|
~97%
ethyl 5-acetylo... CAS#:31720-89-5 |
| Literature: AstraZeneca AB Patent: US6737435 B1, 2004 ; Location in patent: Page/Page column 19 ; US 6737435 B1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-acetoxy-indole-2-carboxylic acid ethyl ester |
| 5-acetoxy-2-carbethoxyindole |
| 5-Acetoxy-2-ethoxycarbonylindol |
| ethyl 5-acetoxyindole-2-carboxylate |