Morpholine,4-[3-(5-phenyl-2H-tetrazol-2-yl)propyl]-
Modify Date: 2025-11-01 00:53:43
![Morpholine,4-[3-(5-phenyl-2H-tetrazol-2-yl)propyl]- Structure](https://image.chemsrc.com/caspic/014/3169-54-8.png)
Morpholine,4-[3-(5-phenyl-2H-tetrazol-2-yl)propyl]- structure
|
Common Name | Morpholine,4-[3-(5-phenyl-2H-tetrazol-2-yl)propyl]- | ||
|---|---|---|---|---|
| CAS Number | 3169-54-8 | Molecular Weight | 273.33400 | |
| Density | 1.27g/cm3 | Boiling Point | 460ºC at 760mmHg | |
| Molecular Formula | C14H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232ºC | |
| Name | 4-[3-(5-phenyltetrazol-2-yl)propyl]morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 460ºC at 760mmHg |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.33400 |
| Flash Point | 232ºC |
| Exact Mass | 273.15900 |
| PSA | 56.07000 |
| LogP | 1.00030 |
| Index of Refraction | 1.645 |
| InChIKey | ZEIIBTHEFRQZQQ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnn(CCCN3CCOCC3)n2)cc1 |
|
~%
Morpholine,4-[3... CAS#:3169-54-8 |
| Literature: Hayao,S. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 400 - 402 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-[3-(5-phenyl-tetrazol-2-yl)-propyl]-morpholine |