Benzamide,N-[2-amino-1-(methylthio)-2-oxoethyl]-4-nitro-
Modify Date: 2025-08-21 19:48:44
![Benzamide,N-[2-amino-1-(methylthio)-2-oxoethyl]-4-nitro- Structure](https://image.chemsrc.com/caspic/185/31666-20-3.png)
Benzamide,N-[2-amino-1-(methylthio)-2-oxoethyl]-4-nitro- structure
|
Common Name | Benzamide,N-[2-amino-1-(methylthio)-2-oxoethyl]-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 31666-20-3 | Molecular Weight | 269.27700 | |
| Density | 1.418g/cm3 | Boiling Point | 535.4ºC at 760mmHg | |
| Molecular Formula | C10H11N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.6ºC | |
| Name | N-(2-amino-1-methylsulfanyl-2-oxoethyl)-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 535.4ºC at 760mmHg |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.27700 |
| Flash Point | 277.6ºC |
| Exact Mass | 269.04700 |
| PSA | 143.31000 |
| LogP | 2.11340 |
| Index of Refraction | 1.626 |
| InChIKey | VTZYUPZPZTZJRS-UHFFFAOYSA-N |
| SMILES | CSC(NC(=O)c1ccc([N+](=O)[O-])cc1)C(N)=O |
|
~%
Benzamide,N-[2-... CAS#:31666-20-3 |
| Literature: Shah; Lam; Ketcham Journal of medicinal chemistry, 1971 , vol. 14, # 5 p. 456 - 458 |
![5-Oxazolamine,4-(methylthio)-2-(4-nitrophenyl)-N-[(4-nitrophenyl)methylene]- structure](https://image.chemsrc.com/caspic/202/31666-15-6.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Methylmercapto-(4-nitro-benzoylamino)-essigsaeure-amid |
| N-[2-amino-1-(methylsulfanyl)-2-oxoethyl]-4-nitrobenzamide |