1-decoxy-4-nitrobenzene
Modify Date: 2025-08-25 16:16:15
1-decoxy-4-nitrobenzene structure
|
Common Name | 1-decoxy-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 31657-37-1 | Molecular Weight | 279.37500 | |
| Density | 1.02 g/cm3 | Boiling Point | 394.7ºC at 760 mmHg | |
| Molecular Formula | C16H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5ºC | |
| Name | 1-decoxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02 g/cm3 |
|---|---|
| Boiling Point | 394.7ºC at 760 mmHg |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.37500 |
| Flash Point | 145.5ºC |
| Exact Mass | 279.18300 |
| PSA | 55.05000 |
| LogP | 5.63750 |
| Index of Refraction | 1.504 |
| InChIKey | FQIOGTJBANMZNX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| FR-1085 |
| 4-decyloxy-1-nitrobenzene |
| 4-Decyloxynitrobenzene |
| p-Nitrophenyl decyl ether |